C14H19NO4 — CID 115174603
methyl 4-(4-methoxy-N,3-dimethylanilino)-4-oxobutanoate (PubChem CID 115174603) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 4-(4-methoxy-N,3-dimethylanilino)-4-oxobutanoate.
| Compound Name | methyl 4-(4-methoxy-N,3-dimethylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 115174603 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl 4-(4-methoxy-N,3-dimethylanilino)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(C)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C14H19NO4/c1-10-9-11(5-6-12(10)18-3)15(2)13(16)7-8-14(17)19-4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | ZFTCCCUWMMKCHX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |