C13H16FNO3 — CID 110779721
methyl 4-[(4-fluoro-3-methylphenyl)methylamino]-4-oxobutanoate (PubChem CID 110779721) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is methyl 4-[(4-fluoro-3-methylphenyl)methylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[(4-fluoro-3-methylphenyl)methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 110779721 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 4-[(4-fluoro-3-methylphenyl)methylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NCc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C13H16FNO3/c1-9-7-10(3-4-11(9)14)8-15-12(16)5-6-13(17)18-2/h3-4,7H,5-6,8H2,1-2H3,(H,15,16) |
| InChIKey | FBUHKNNCFIVWNF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |