C9H12FN3O — CID 115192598
1-amino-3-[(4-fluoro-3-methylphenyl)methyl]urea (PubChem CID 115192598) has the molecular formula C9H12FN3O and a molecular weight of 197.21 g/mol. Its IUPAC name is 1-amino-3-[(4-fluoro-3-methylphenyl)methyl]urea.
| Compound Name | 1-amino-3-[(4-fluoro-3-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 115192598 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-amino-3-[(4-fluoro-3-methylphenyl)methyl]urea |
| SMILES | Cc1cc(CNC(=O)NN)ccc1F |
| InChI | InChI=1S/C9H12FN3O/c1-6-4-7(2-3-8(6)10)5-12-9(14)13-11/h2-4H,5,11H2,1H3,(H2,12,13,14) |
| InChIKey | HTUGTVOBKORHLV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|