C12H11F2NO — CID 61311256
2-(2,6-difluorobenzoyl)-3-methylbutanenitrile (PubChem CID 61311256) has the molecular formula C12H11F2NO and a molecular weight of 223.22 g/mol. Its IUPAC name is 2-(2,6-difluorobenzoyl)-3-methylbutanenitrile.
| Compound Name | 2-(2,6-difluorobenzoyl)-3-methylbutanenitrile |
|---|---|
| PubChem CID | 61311256 |
| Molecular Formula | C12H11F2NO |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(2,6-difluorobenzoyl)-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C12H11F2NO/c1-7(2)8(6-15)12(16)11-9(13)4-3-5-10(11)14/h3-5,7-8H,1-2H3 |
| InChIKey | GUGJDBQTUSFQNA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |