C11H8Cl2FN3O — CID 173362943
2-(2,6-dichloro-5-fluoropyridine-3-carbonyl)-3-(dimethylamino)prop-2-enenitrile (PubChem CID 173362943) has the molecular formula C11H8Cl2FN3O and a molecular weight of 288.11 g/mol. Its IUPAC name is 2-(2,6-dichloro-5-fluoropyridine-3-carbonyl)-3-(dimethylamino)prop-2-enenitrile.
| Compound Name | 2-(2,6-dichloro-5-fluoropyridine-3-carbonyl)-3-(dimethylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 173362943 |
| Molecular Formula | C11H8Cl2FN3O |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-(2,6-dichloro-5-fluoropyridine-3-carbonyl)-3-(dimethylamino)prop-2-enenitrile |
| SMILES | CN(C)C=C(C#N)C(=O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C11H8Cl2FN3O/c1-17(2)5-6(4-15)9(18)7-3-8(14)11(13)16-10(7)12/h3,5H,1-2H3 |
| InChIKey | JUGPIQJZXUPAHL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|