C17H18FIN4O2S — CID 145211765
[2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-formamidoindol-1-yl] thiohypoiodite;ethane (PubChem CID 145211765) has the molecular formula C17H18FIN4O2S and a molecular weight of 488.33 g/mol. Its IUPAC name is [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-formamidoindol-1-yl] thiohypoiodite;ethane.
| Compound Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-formamidoindol-1-yl] thiohypoiodite;ethane |
|---|---|
| PubChem CID | 145211765 |
| Molecular Formula | C17H18FIN4O2S |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-formamidoindol-1-yl] thiohypoiodite;ethane |
| SMILES | CC.CN(C)/C=C(\C#N)C(=O)c1cc2cc(F)c(NC=O)cc2n1SI |
| InChI | InChI=1S/C15H12FIN4O2S.C2H6/c1-20(2)7-10(6-18)15(23)14-4-9-3-11(16)12(19-8-22)5-13(9)21(14)24-17;1-2/h3-5,7-8H,1-2H3,(H,19,22);1-2H3/b10-7+; |
| InChIKey | WLEAXEBNPALTNG-HCUGZAAXSA-N |
| XLogP | 4.37 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|