C16H13FIN3O2S2 — CID 145211908
[2-[(E)-2-cyanobut-2-enoyl]-6-(cyclopropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite (PubChem CID 145211908) has the molecular formula C16H13FIN3O2S2 and a molecular weight of 489.34 g/mol. Its IUPAC name is [2-[(E)-2-cyanobut-2-enoyl]-6-(cyclopropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite.
| Compound Name | [2-[(E)-2-cyanobut-2-enoyl]-6-(cyclopropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite |
|---|---|
| PubChem CID | 145211908 |
| Molecular Formula | C16H13FIN3O2S2 |
| Molecular Weight | 489.34 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | [2-[(E)-2-cyanobut-2-enoyl]-6-(cyclopropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite |
| SMILES | C/C=C(\C#N)C(=O)c1cc2cc(OF)c(NSC3CC3)cc2n1SI |
| InChI | InChI=1S/C16H13FIN3O2S2/c1-2-9(8-19)16(22)14-5-10-6-15(23-17)12(20-24-11-3-4-11)7-13(10)21(14)25-18/h2,5-7,11,20H,3-4H2,1H3/b9-2+ |
| InChIKey | HCBYURDKJAQXSS-XNWCZRBMSA-N |
| XLogP | 5.63 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|