C18H20F2N4O2S — CID 134448460
[2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-methylindol-5-yl] hypofluorite (PubChem CID 134448460) has the molecular formula C18H20F2N4O2S and a molecular weight of 394.45 g/mol. Its IUPAC name is [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-methylindol-5-yl] hypofluorite.
| Compound Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-methylindol-5-yl] hypofluorite |
|---|---|
| PubChem CID | 134448460 |
| Molecular Formula | C18H20F2N4O2S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-methylindol-5-yl] hypofluorite |
| SMILES | CN(C)/C=C(\C#N)C(=O)c1cc2cc(OF)c(NSCCCF)cc2n1C |
| InChI | InChI=1S/C18H20F2N4O2S/c1-23(2)11-13(10-21)18(25)16-7-12-8-17(26-20)14(9-15(12)24(16)3)22-27-6-4-5-19/h7-9,11,22H,4-6H2,1-3H3/b13-11+ |
| InChIKey | UGAZHLXRDTXZNM-ACCUITESSA-N |
| XLogP | 4.01 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|