C16H17IN4OS — CID 134448689
(E)-3-(dimethylamino)-2-[1-iodo-5-methyl-6-(methylsulfanylamino)indole-2-carbonyl]prop-2-enenitrile (PubChem CID 134448689) has the molecular formula C16H17IN4OS and a molecular weight of 440.31 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-2-[1-iodo-5-methyl-6-(methylsulfanylamino)indole-2-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(dimethylamino)-2-[1-iodo-5-methyl-6-(methylsulfanylamino)indole-2-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 134448689 |
| Molecular Formula | C16H17IN4OS |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | (E)-3-(dimethylamino)-2-[1-iodo-5-methyl-6-(methylsulfanylamino)indole-2-carbonyl]prop-2-enenitrile |
| SMILES | CSNc1cc2c(cc1C)cc(C(=O)/C(C#N)=C/N(C)C)n2I |
| InChI | InChI=1S/C16H17IN4OS/c1-10-5-11-6-15(16(22)12(8-18)9-20(2)3)21(17)14(11)7-13(10)19-23-4/h5-7,9,19H,1-4H3/b12-9+ |
| InChIKey | NDZXVRKWOLCYGN-FMIVXFBMSA-N |
| XLogP | 3.99 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|