C14H11FIN3O2S2 — CID 145211285
[2-[(E)-2-cyanobut-2-enoyl]-1-iodosulfanyl-6-(methylsulfanylamino)indol-5-yl] hypofluorite (PubChem CID 145211285) has the molecular formula C14H11FIN3O2S2 and a molecular weight of 463.30 g/mol. Its IUPAC name is [2-[(E)-2-cyanobut-2-enoyl]-1-iodosulfanyl-6-(methylsulfanylamino)indol-5-yl] hypofluorite.
| Compound Name | [2-[(E)-2-cyanobut-2-enoyl]-1-iodosulfanyl-6-(methylsulfanylamino)indol-5-yl] hypofluorite |
|---|---|
| PubChem CID | 145211285 |
| Molecular Formula | C14H11FIN3O2S2 |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 462.93 |
| IUPAC Name | [2-[(E)-2-cyanobut-2-enoyl]-1-iodosulfanyl-6-(methylsulfanylamino)indol-5-yl] hypofluorite |
| SMILES | C/C=C(\C#N)C(=O)c1cc2cc(OF)c(NSC)cc2n1SI |
| InChI | InChI=1S/C14H11FIN3O2S2/c1-3-8(7-17)14(20)12-4-9-5-13(21-15)10(18-22-2)6-11(9)19(12)23-16/h3-6,18H,1-2H3/b8-3+ |
| InChIKey | UMDASGWTUWLSCW-FPYGCLRLSA-N |
| XLogP | 5.09 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|