C17H21IN2O2S — CID 134449390
tert-butyl N-(1-iodosulfanyl-5-methyl-2-prop-1-en-2-ylindol-6-yl)carbamate (PubChem CID 134449390) has the molecular formula C17H21IN2O2S and a molecular weight of 444.34 g/mol. Its IUPAC name is tert-butyl N-(1-iodosulfanyl-5-methyl-2-prop-1-en-2-ylindol-6-yl)carbamate.
| Compound Name | tert-butyl N-(1-iodosulfanyl-5-methyl-2-prop-1-en-2-ylindol-6-yl)carbamate |
|---|---|
| PubChem CID | 134449390 |
| Molecular Formula | C17H21IN2O2S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | tert-butyl N-(1-iodosulfanyl-5-methyl-2-prop-1-en-2-ylindol-6-yl)carbamate |
| SMILES | C=C(C)c1cc2cc(C)c(NC(=O)OC(C)(C)C)cc2n1SI |
| InChI | InChI=1S/C17H21IN2O2S/c1-10(2)14-8-12-7-11(3)13(9-15(12)20(14)23-18)19-16(21)22-17(4,5)6/h7-9H,1H2,2-6H3,(H,19,21) |
| InChIKey | FNABMXCGGQIGPH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|