C17H17F2IN4O2S2 — CID 134448417
[2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite (PubChem CID 134448417) has the molecular formula C17H17F2IN4O2S2 and a molecular weight of 538.38 g/mol. Its IUPAC name is [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite.
| Compound Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite |
|---|---|
| PubChem CID | 134448417 |
| Molecular Formula | C17H17F2IN4O2S2 |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-6-(3-fluoropropylsulfanylamino)-1-iodosulfanylindol-5-yl] hypofluorite |
| SMILES | CN(C)/C=C(\C#N)C(=O)c1cc2cc(OF)c(NSCCCF)cc2n1SI |
| InChI | InChI=1S/C17H17F2IN4O2S2/c1-23(2)10-12(9-21)17(25)15-6-11-7-16(26-19)13(22-27-5-3-4-18)8-14(11)24(15)28-20/h6-8,10,22H,3-5H2,1-2H3/b12-10+ |
| InChIKey | SMHPILWXYGFRJE-ZRDIBKRKSA-N |
| XLogP | 5.32 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|