C15H14FIN4O3S2 — CID 146258101
[2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-(methanesulfonamido)indol-1-yl] thiohypoiodite (PubChem CID 146258101) has the molecular formula C15H14FIN4O3S2 and a molecular weight of 508.34 g/mol. Its IUPAC name is [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-(methanesulfonamido)indol-1-yl] thiohypoiodite.
| Compound Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-(methanesulfonamido)indol-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 146258101 |
| Molecular Formula | C15H14FIN4O3S2 |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | [2-[(E)-2-cyano-3-(dimethylamino)prop-2-enoyl]-5-fluoro-6-(methanesulfonamido)indol-1-yl] thiohypoiodite |
| SMILES | CN(C)/C=C(\C#N)C(=O)c1cc2cc(F)c(NS(C)(=O)=O)cc2n1SI |
| InChI | InChI=1S/C15H14FIN4O3S2/c1-20(2)8-10(7-18)15(22)14-5-9-4-11(16)12(19-26(3,23)24)6-13(9)21(14)25-17/h4-6,8,19H,1-3H3/b10-8+ |
| InChIKey | CHWASQLFWHDYIK-CSKARUKUSA-N |
| XLogP | 3.15 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|