C20H16FN3O3S — CID 135144303
(Z)-2-[1-(benzenesulfonyl)-5-fluoroindole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile (PubChem CID 135144303) has the molecular formula C20H16FN3O3S and a molecular weight of 397.43 g/mol. Its IUPAC name is (Z)-2-[1-(benzenesulfonyl)-5-fluoroindole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile.
| Compound Name | (Z)-2-[1-(benzenesulfonyl)-5-fluoroindole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 135144303 |
| Molecular Formula | C20H16FN3O3S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (Z)-2-[1-(benzenesulfonyl)-5-fluoroindole-2-carbonyl]-3-(dimethylamino)prop-2-enenitrile |
| SMILES | CN(C)/C=C(/C#N)C(=O)c1cc2cc(F)ccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16FN3O3S/c1-23(2)13-15(12-22)20(25)19-11-14-10-16(21)8-9-18(14)24(19)28(26,27)17-6-4-3-5-7-17/h3-11,13H,1-2H3/b15-13- |
| InChIKey | DOEATZDXIIPMCA-SQFISAMPSA-N |
| XLogP | 3.17 |
| TPSA | 83.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|