C16H16IN3O — CID 134449680
(E)-3-(dimethylamino)-2-(1-iodo-5,6-dimethylindole-2-carbonyl)prop-2-enenitrile (PubChem CID 134449680) has the molecular formula C16H16IN3O and a molecular weight of 393.23 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-2-(1-iodo-5,6-dimethylindole-2-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(dimethylamino)-2-(1-iodo-5,6-dimethylindole-2-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 134449680 |
| Molecular Formula | C16H16IN3O |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | (E)-3-(dimethylamino)-2-(1-iodo-5,6-dimethylindole-2-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc2cc(C(=O)/C(C#N)=C/N(C)C)n(I)c2cc1C |
| InChI | InChI=1S/C16H16IN3O/c1-10-5-12-7-15(20(17)14(12)6-11(10)2)16(21)13(8-18)9-19(3)4/h5-7,9H,1-4H3/b13-9+ |
| InChIKey | PDIYSIXLNNXPJI-UKTHLTGXSA-N |
| XLogP | 3.61 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|