C18H31F2NSi — CID 87114746
N-butyl-2,4-difluoro-N-[hexyl(dimethyl)silyl]aniline (PubChem CID 87114746) has the molecular formula C18H31F2NSi and a molecular weight of 327.54 g/mol. Its IUPAC name is N-butyl-2,4-difluoro-N-[hexyl(dimethyl)silyl]aniline.
| Compound Name | N-butyl-2,4-difluoro-N-[hexyl(dimethyl)silyl]aniline |
|---|---|
| PubChem CID | 87114746 |
| Molecular Formula | C18H31F2NSi |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | N-butyl-2,4-difluoro-N-[hexyl(dimethyl)silyl]aniline |
| SMILES | CCCCCC[Si](C)(C)N(CCCC)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H31F2NSi/c1-5-7-9-10-14-22(3,4)21(13-8-6-2)18-12-11-16(19)15-17(18)20/h11-12,15H,5-10,13-14H2,1-4H3 |
| InChIKey | YKKTZOFPAMGECS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|