C17H18ClF2N — CID 87694469
N-butyl-N-[(4-chlorophenyl)methyl]-2,4-difluoroaniline (PubChem CID 87694469) has the molecular formula C17H18ClF2N and a molecular weight of 309.79 g/mol. Its IUPAC name is N-butyl-N-[(4-chlorophenyl)methyl]-2,4-difluoroaniline.
| Compound Name | N-butyl-N-[(4-chlorophenyl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 87694469 |
| Molecular Formula | C17H18ClF2N |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-butyl-N-[(4-chlorophenyl)methyl]-2,4-difluoroaniline |
| SMILES | CCCCN(Cc1ccc(Cl)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H18ClF2N/c1-2-3-10-21(12-13-4-6-14(18)7-5-13)17-9-8-15(19)11-16(17)20/h4-9,11H,2-3,10,12H2,1H3 |
| InChIKey | OJZTXSBIXXMHPY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |