C19H25F2NO — CID 21494508
N-butyl-N-(3-ethylhex-4-yn-3-yl)-2,4-difluorobenzamide (PubChem CID 21494508) has the molecular formula C19H25F2NO and a molecular weight of 321.41 g/mol. Its IUPAC name is N-butyl-N-(3-ethylhex-4-yn-3-yl)-2,4-difluorobenzamide.
| Compound Name | N-butyl-N-(3-ethylhex-4-yn-3-yl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 21494508 |
| Molecular Formula | C19H25F2NO |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-butyl-N-(3-ethylhex-4-yn-3-yl)-2,4-difluorobenzamide |
| SMILES | CC#CC(CC)(CC)N(CCCC)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H25F2NO/c1-5-9-13-22(19(7-3,8-4)12-6-2)18(23)16-11-10-15(20)14-17(16)21/h10-11,14H,5,7-9,13H2,1-4H3 |
| InChIKey | FDMDFTJNDWHBOV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|