C24H42N2O3 — CID 157108849
N,N-bis(2-ethylhexyl)-2-nitrobenzamide;methane (PubChem CID 157108849) has the molecular formula C24H42N2O3 and a molecular weight of 406.61 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-2-nitrobenzamide;methane.
| Compound Name | N,N-bis(2-ethylhexyl)-2-nitrobenzamide;methane |
|---|---|
| PubChem CID | 157108849 |
| Molecular Formula | C24H42N2O3 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-2-nitrobenzamide;methane |
| SMILES | C.CCCCC(CC)CN(CC(CC)CCCC)C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H38N2O3.CH4/c1-5-9-13-19(7-3)17-24(18-20(8-4)14-10-6-2)23(26)21-15-11-12-16-22(21)25(27)28;/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3;1H4 |
| InChIKey | AGPOMUXXWLIUSS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|