C38H71N3O4S — CID 45049271
4-[bis(2-ethylhexyl)amino]-N,N-bis(2-ethylhexyl)-3-nitrobenzenesulfonamide (PubChem CID 45049271) has the molecular formula C38H71N3O4S and a molecular weight of 666.07 g/mol. Its IUPAC name is 4-[bis(2-ethylhexyl)amino]-N,N-bis(2-ethylhexyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[bis(2-ethylhexyl)amino]-N,N-bis(2-ethylhexyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 45049271 |
| Molecular Formula | C38H71N3O4S |
| Molecular Weight | 666.07 g/mol |
| Exact Mass | 665.52 |
| IUPAC Name | 4-[bis(2-ethylhexyl)amino]-N,N-bis(2-ethylhexyl)-3-nitrobenzenesulfonamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc(S(=O)(=O)N(CC(CC)CCCC)CC(CC)CCCC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C38H71N3O4S/c1-9-17-21-32(13-5)28-39(29-33(14-6)22-18-10-2)37-26-25-36(27-38(37)41(42)43)46(44,45)40(30-34(15-7)23-19-11-3)31-35(16-8)24-20-12-4/h25-27,32-35H,9-24,28-31H2,1-8H3 |
| InChIKey | RUCJKKLQMDGLQJ-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.07 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|