C14H23N3O5S — CID 56806804
4-[2-hydroxyethyl(propyl)amino]-3-nitro-N-propan-2-ylbenzenesulfonamide (PubChem CID 56806804) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(propyl)amino]-3-nitro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[2-hydroxyethyl(propyl)amino]-3-nitro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 56806804 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-[2-hydroxyethyl(propyl)amino]-3-nitro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCCN(CCO)c1ccc(S(=O)(=O)NC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H23N3O5S/c1-4-7-16(8-9-18)13-6-5-12(10-14(13)17(19)20)23(21,22)15-11(2)3/h5-6,10-11,15,18H,4,7-9H2,1-3H3 |
| InChIKey | YCNFLQISFXTFRI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|