C16H26N4O5S — CID 9184627
2-[4-(diethylsulfamoyl)-N-methyl-2-nitroanilino]-N-propylacetamide (PubChem CID 9184627) has the molecular formula C16H26N4O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)-N-methyl-2-nitroanilino]-N-propylacetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)-N-methyl-2-nitroanilino]-N-propylacetamide |
|---|---|
| PubChem CID | 9184627 |
| Molecular Formula | C16H26N4O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)-N-methyl-2-nitroanilino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)c1ccc(S(=O)(=O)N(CC)CC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H26N4O5S/c1-5-10-17-16(21)12-18(4)14-9-8-13(11-15(14)20(22)23)26(24,25)19(6-2)7-3/h8-9,11H,5-7,10,12H2,1-4H3,(H,17,21) |
| InChIKey | PXJFHZMMIUCPPY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|