C13H18F2N2O — CID 54987846
N-(3-amino-2-methylpropyl)-N-ethyl-2,4-difluorobenzamide (PubChem CID 54987846) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-N-ethyl-2,4-difluorobenzamide.
| Compound Name | N-(3-amino-2-methylpropyl)-N-ethyl-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 54987846 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-N-ethyl-2,4-difluorobenzamide |
| SMILES | CCN(CC(C)CN)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H18F2N2O/c1-3-17(8-9(2)7-16)13(18)11-5-4-10(14)6-12(11)15/h4-6,9H,3,7-8,16H2,1-2H3 |
| InChIKey | IARSEECTVIJPEB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |