C15H17F5O — CID 114963755
3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)heptan-1-one (PubChem CID 114963755) has the molecular formula C15H17F5O and a molecular weight of 308.29 g/mol. Its IUPAC name is 3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)heptan-1-one.
| Compound Name | 3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)heptan-1-one |
|---|---|
| PubChem CID | 114963755 |
| Molecular Formula | C15H17F5O |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-ethyl-1-(2,3,4,5,6-pentafluorophenyl)heptan-1-one |
| SMILES | CCCCC(CC)CC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H17F5O/c1-3-5-6-8(4-2)7-9(21)10-11(16)13(18)15(20)14(19)12(10)17/h8H,3-7H2,1-2H3 |
| InChIKey | MLFJEOAWFLBOFR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|