About zinc bis(3-ethylheptanoate)
zinc bis(3-ethylheptanoate) (PubChem CID 159696376) has the molecular formula C18H34O4Zn
and a molecular weight of 379.86 g/mol. Its IUPAC name is zinc bis(3-ethylheptanoate).
Molecular Properties
| Compound Name | zinc bis(3-ethylheptanoate) |
| PubChem CID | 159696376 |
| Molecular Formula | C18H34O4Zn |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | zinc bis(3-ethylheptanoate) |
| SMILES | CCCCC(CC)CC(=O)[O-].CCCCC(CC)CC(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C9H18O2.Zn/c2*1-3-5-6-8(4-2)7-9(10)11;/h2*8H,3-7H2,1-2H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | MXBGTUMPYKJTAY-UHFFFAOYSA-L |
| XLogP | 2.68 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(3-ethylheptanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(3-ethylheptanoate)?
The IUPAC name of zinc bis(3-ethylheptanoate) (CID 159696376) is zinc bis(3-ethylheptanoate).
What is the SMILES notation for zinc bis(3-ethylheptanoate)?
The canonical SMILES for zinc bis(3-ethylheptanoate) is CCCCC(CC)CC(=O)[O-].CCCCC(CC)CC(=O)[O-].[Zn+2].
What is the InChIKey of zinc bis(3-ethylheptanoate)?
The InChIKey is MXBGTUMPYKJTAY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H18O2.Zn/c2*1-3-5-6-8(4-2)7-9(10)11;/h2*8H,3-7H2,1-2H3,(H,10,11);/q;;+2/p-2.
What are the key properties of zinc bis(3-ethylheptanoate)?
zinc bis(3-ethylheptanoate) has a molecular weight of 379.86 g/mol, XLogP of 2.68, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(3-ethylheptanoate) is sourced from PubChem (CID 159696376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).