About sodium 9-ethyloctadecanoate
sodium 9-ethyloctadecanoate (PubChem CID 23382374) has the molecular formula C20H39NaO2
and a molecular weight of 334.52 g/mol. Its IUPAC name is sodium 9-ethyloctadecanoate.
Molecular Properties
| Compound Name | sodium 9-ethyloctadecanoate |
| PubChem CID | 23382374 |
| Molecular Formula | C20H39NaO2 |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | sodium 9-ethyloctadecanoate |
| SMILES | CCCCCCCCCC(CC)CCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H40O2.Na/c1-3-5-6-7-8-10-13-16-19(4-2)17-14-11-9-12-15-18-20(21)22;/h19H,3-18H2,1-2H3,(H,21,22);/q;+1/p-1 |
| InChIKey | OPDOKFNOICZQJJ-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 9-ethyloctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 9-ethyloctadecanoate?
The IUPAC name of sodium 9-ethyloctadecanoate (CID 23382374) is sodium 9-ethyloctadecanoate.
What is the SMILES notation for sodium 9-ethyloctadecanoate?
The canonical SMILES for sodium 9-ethyloctadecanoate is CCCCCCCCCC(CC)CCCCCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium 9-ethyloctadecanoate?
The InChIKey is OPDOKFNOICZQJJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H40O2.Na/c1-3-5-6-7-8-10-13-16-19(4-2)17-14-11-9-12-15-18-20(21)22;/h19H,3-18H2,1-2H3,(H,21,22);/q;+1/p-1.
What are the key properties of sodium 9-ethyloctadecanoate?
sodium 9-ethyloctadecanoate has a molecular weight of 334.52 g/mol, XLogP of 2.64, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 9-ethyloctadecanoate is sourced from PubChem (CID 23382374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).