C12H14F2O2 — CID 62197357
1-(2,4-difluorophenyl)-3-propoxypropan-2-one (PubChem CID 62197357) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-propoxypropan-2-one.
| Compound Name | 1-(2,4-difluorophenyl)-3-propoxypropan-2-one |
|---|---|
| PubChem CID | 62197357 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-propoxypropan-2-one |
| SMILES | CCCOCC(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2O2/c1-2-5-16-8-11(15)6-9-3-4-10(13)7-12(9)14/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | OAFXKHQXGFTZOK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|