C21H15BrN2S — CID 129037947
4-bromo-7-(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole (PubChem CID 129037947) has the molecular formula C21H15BrN2S and a molecular weight of 407.34 g/mol. Its IUPAC name is 4-bromo-7-(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4-bromo-7-(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 129037947 |
| Molecular Formula | C21H15BrN2S |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4-bromo-7-(9,9-dimethylfluoren-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(Br)c4nsnc34)cc21 |
| InChI | InChI=1S/C21H15BrN2S/c1-21(2)16-6-4-3-5-14(16)15-8-7-12(11-17(15)21)13-9-10-18(22)20-19(13)23-25-24-20/h3-11H,1-2H3 |
| InChIKey | WGPFKJRBOANWCK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |