C23H20N2S — CID 20593658
7-methyl-4-(7,9,9-trimethylfluoren-2-yl)-2,1,3-benzothiadiazole (PubChem CID 20593658) has the molecular formula C23H20N2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 7-methyl-4-(7,9,9-trimethylfluoren-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 7-methyl-4-(7,9,9-trimethylfluoren-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 20593658 |
| Molecular Formula | C23H20N2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 7-methyl-4-(7,9,9-trimethylfluoren-2-yl)-2,1,3-benzothiadiazole |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-c3ccc(C)c4nsnc34)ccc1-2 |
| InChI | InChI=1S/C23H20N2S/c1-13-5-8-17-18-10-7-15(12-20(18)23(3,4)19(17)11-13)16-9-6-14(2)21-22(16)25-26-24-21/h5-12H,1-4H3 |
| InChIKey | JCZRDYLABWHAKR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |