C26H34 — CID 90801139
ethane;3,5,7,7,9-pentamethylbenzo[a]phenalene (PubChem CID 90801139) has the molecular formula C26H34 and a molecular weight of 346.56 g/mol. Its IUPAC name is ethane;3,5,7,7,9-pentamethylbenzo[a]phenalene.
| Compound Name | ethane;3,5,7,7,9-pentamethylbenzo[a]phenalene |
|---|---|
| PubChem CID | 90801139 |
| Molecular Formula | C26H34 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | ethane;3,5,7,7,9-pentamethylbenzo[a]phenalene |
| SMILES | CC.CC.Cc1ccc2c(c1)C(C)(C)c1cc(C)cc3c(C)ccc-2c13 |
| InChI | InChI=1S/C22H22.2C2H6/c1-13-6-8-16-17-9-7-15(3)18-10-14(2)12-20(21(17)18)22(4,5)19(16)11-13;2*1-2/h6-12H,1-5H3;2*1-2H3 |
| InChIKey | MSNUHAARBBMPDM-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |