C16H17BO2 — CID 125469672
(7,9,9-trimethylfluoren-2-yl)boronic acid (PubChem CID 125469672) has the molecular formula C16H17BO2 and a molecular weight of 252.12 g/mol. Its IUPAC name is (7,9,9-trimethylfluoren-2-yl)boronic acid.
| Compound Name | (7,9,9-trimethylfluoren-2-yl)boronic acid |
|---|---|
| PubChem CID | 125469672 |
| Molecular Formula | C16H17BO2 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (7,9,9-trimethylfluoren-2-yl)boronic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(B(O)O)ccc1-2 |
| InChI | InChI=1S/C16H17BO2/c1-10-4-6-12-13-7-5-11(17(18)19)9-15(13)16(2,3)14(12)8-10/h4-9,18-19H,1-3H3 |
| InChIKey | IDNYCCRVSZJLSB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|