C14H14BNO2 — CID 142724289
(5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid (PubChem CID 142724289) has the molecular formula C14H14BNO2 and a molecular weight of 239.08 g/mol. Its IUPAC name is (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid.
| Compound Name | (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid |
|---|---|
| PubChem CID | 142724289 |
| Molecular Formula | C14H14BNO2 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid |
| SMILES | CC1(C)c2ccncc2-c2ccc(B(O)O)cc21 |
| InChI | InChI=1S/C14H14BNO2/c1-14(2)12-5-6-16-8-11(12)10-4-3-9(15(17)18)7-13(10)14/h3-8,17-18H,1-2H3 |
| InChIKey | OZXIABWWDJACLK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|