(5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid

C14H14BNO2 — CID 142724289

IUPAC(5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid
SMILESCC1(C)c2ccncc2-c2ccc(B(O)O)cc21
InChIInChI=1S/C14H14BNO2/c1-14(2)12-5-6-16-8-11(12)10-4-3-9(15(17)18)7-13(10)14/h3-8,17-18H,1-2H3
InChIKeyOZXIABWWDJACLK-UHFFFAOYSA-N
MW239.08 g/mol
LogP1.07
Rot. Bonds1

About (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid

(5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid (PubChem CID 142724289) has the molecular formula C14H14BNO2 and a molecular weight of 239.08 g/mol. Its IUPAC name is (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid.

Molecular Properties

Compound Name(5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid
PubChem CID142724289
Molecular FormulaC14H14BNO2
Molecular Weight239.08 g/mol
Exact Mass239.11
IUPAC Name(5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid
SMILESCC1(C)c2ccncc2-c2ccc(B(O)O)cc21
InChIInChI=1S/C14H14BNO2/c1-14(2)12-5-6-16-8-11(12)10-4-3-9(15(17)18)7-13(10)14/h3-8,17-18H,1-2H3
InChIKeyOZXIABWWDJACLK-UHFFFAOYSA-N
XLogP1.07
TPSA53.35 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.08
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid?
The IUPAC name of (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid (CID 142724289) is (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid.
What is the SMILES notation for (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid?
The canonical SMILES for (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid is CC1(C)c2ccncc2-c2ccc(B(O)O)cc21.
What is the InChIKey of (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid?
The InChIKey is OZXIABWWDJACLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BNO2/c1-14(2)12-5-6-16-8-11(12)10-4-3-9(15(17)18)7-13(10)14/h3-8,17-18H,1-2H3.
What are the key properties of (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid?
(5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid has a molecular weight of 239.08 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethylindeno[1,2-c]pyridin-7-yl)boronic acid is sourced from PubChem (CID 142724289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).