C25H18B2O4 — CID 121230960
(2'-borono-9,9'-spirobi[fluorene]-2-yl)boronic acid (PubChem CID 121230960) has the molecular formula C25H18B2O4 and a molecular weight of 404.04 g/mol. Its IUPAC name is (2'-borono-9,9'-spirobi[fluorene]-2-yl)boronic acid.
| Compound Name | (2'-borono-9,9'-spirobi[fluorene]-2-yl)boronic acid |
|---|---|
| PubChem CID | 121230960 |
| Molecular Formula | C25H18B2O4 |
| Molecular Weight | 404.04 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2'-borono-9,9'-spirobi[fluorene]-2-yl)boronic acid |
| SMILES | OB(O)c1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2-c2ccc(B(O)O)cc21 |
| InChI | InChI=1S/C25H18B2O4/c28-26(29)15-9-11-19-17-5-1-3-7-21(17)25(23(19)13-15)22-8-4-2-6-18(22)20-12-10-16(27(30)31)14-24(20)25/h1-14,28-31H |
| InChIKey | DFILURRLHYVTKW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.04 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|