9,9'-spirobi[fluorene]-2-ylphosphinous acid

C25H17OP — CID 166990702

IUPAC9,9'-spirobi[fluorene]-2-ylphosphinous acid
SMILESOPc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2
InChIInChI=1S/C25H17OP/c26-27-16-13-14-20-19-9-3-6-12-23(19)25(24(20)15-16)21-10-4-1-7-17(21)18-8-2-5-11-22(18)25/h1-15,26-27H
InChIKeyMKRLDAFIRCYVFB-UHFFFAOYSA-N
MW364.38 g/mol
LogP5.24
Rot. Bonds1

About 9,9'-spirobi[fluorene]-2-ylphosphinous acid

9,9'-spirobi[fluorene]-2-ylphosphinous acid (PubChem CID 166990702) has the molecular formula C25H17OP and a molecular weight of 364.38 g/mol. Its IUPAC name is 9,9'-spirobi[fluorene]-2-ylphosphinous acid.

Molecular Properties

Compound Name9,9'-spirobi[fluorene]-2-ylphosphinous acid
PubChem CID166990702
Molecular FormulaC25H17OP
Molecular Weight364.38 g/mol
Exact Mass364.10
IUPAC Name9,9'-spirobi[fluorene]-2-ylphosphinous acid
SMILESOPc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2
InChIInChI=1S/C25H17OP/c26-27-16-13-14-20-19-9-3-6-12-23(19)25(24(20)15-16)21-10-4-1-7-17(21)18-8-2-5-11-22(18)25/h1-15,26-27H
InChIKeyMKRLDAFIRCYVFB-UHFFFAOYSA-N
XLogP5.24
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500364.38
LogP ≤ 55.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 9,9'-spirobi[fluorene]-2-ylphosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9,9'-spirobi[fluorene]-2-ylphosphinous acid?
The IUPAC name of 9,9'-spirobi[fluorene]-2-ylphosphinous acid (CID 166990702) is 9,9'-spirobi[fluorene]-2-ylphosphinous acid.
What is the SMILES notation for 9,9'-spirobi[fluorene]-2-ylphosphinous acid?
The canonical SMILES for 9,9'-spirobi[fluorene]-2-ylphosphinous acid is OPc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2.
What is the InChIKey of 9,9'-spirobi[fluorene]-2-ylphosphinous acid?
The InChIKey is MKRLDAFIRCYVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17OP/c26-27-16-13-14-20-19-9-3-6-12-23(19)25(24(20)15-16)21-10-4-1-7-17(21)18-8-2-5-11-22(18)25/h1-15,26-27H.
What are the key properties of 9,9'-spirobi[fluorene]-2-ylphosphinous acid?
9,9'-spirobi[fluorene]-2-ylphosphinous acid has a molecular weight of 364.38 g/mol, XLogP of 5.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9'-spirobi[fluorene]-2-ylphosphinous acid is sourced from PubChem (CID 166990702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).