About CID 147413538
CID 147413538 (PubChem CID 147413538) has the molecular formula C25H14B2
and a molecular weight of 336.01 g/mol.
Molecular Properties
| Compound Name | CID 147413538 |
| PubChem CID | 147413538 |
| Molecular Formula | C25H14B2 |
| Molecular Weight | 336.01 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1cc([B])ccc1-2 |
| InChI | InChI=1S/C25H14B2/c26-15-9-11-19-20-12-10-16(27)14-24(20)25(23(19)13-15)21-7-3-1-5-17(21)18-6-2-4-8-22(18)25/h1-14H |
| InChIKey | USNAXMKQHCJINE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.01 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 147413538 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147413538?
The IUPAC name of CID 147413538 (CID 147413538) is not available.
What is the SMILES notation for CID 147413538?
The canonical SMILES for CID 147413538 is [B]c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1cc([B])ccc1-2.
What is the InChIKey of CID 147413538?
The InChIKey is USNAXMKQHCJINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H14B2/c26-15-9-11-19-20-12-10-16(27)14-24(20)25(23(19)13-15)21-7-3-1-5-17(21)18-6-2-4-8-22(18)25/h1-14H.
What are the key properties of CID 147413538?
CID 147413538 has a molecular weight of 336.01 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147413538 is sourced from PubChem (CID 147413538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).