C17H17B — CID 173482166
CID 173482166 (PubChem CID 173482166) has the molecular formula C17H17B and a molecular weight of 232.13 g/mol.
| Compound Name | CID 173482166 |
|---|---|
| PubChem CID | 173482166 |
| Molecular Formula | C17H17B |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(CC)(CC)c1ccccc1-2 |
| InChI | InChI=1S/C17H17B/c1-3-17(4-2)15-8-6-5-7-13(15)14-10-9-12(18)11-16(14)17/h5-11H,3-4H2,1-2H3 |
| InChIKey | RBDQALWZMVMWKA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|