C20H22O — CID 122485363
1-(9,9-diethylfluoren-2-yl)propan-1-one (PubChem CID 122485363) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(9,9-diethylfluoren-2-yl)propan-1-one.
| Compound Name | 1-(9,9-diethylfluoren-2-yl)propan-1-one |
|---|---|
| PubChem CID | 122485363 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(9,9-diethylfluoren-2-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc2c(c1)C(CC)(CC)c1ccccc1-2 |
| InChI | InChI=1S/C20H22O/c1-4-19(21)14-11-12-16-15-9-7-8-10-17(15)20(5-2,6-3)18(16)13-14/h7-13H,4-6H2,1-3H3 |
| InChIKey | RYVRLBHKGNRXTE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |