C36H34N2O4 — CID 122485360
[(E)-[(4Z)-4-benzoyloxyimino-4-(9,9-diethylfluoren-2-yl)-3-methylbutan-2-ylidene]amino] benzoate (PubChem CID 122485360) has the molecular formula C36H34N2O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is [(E)-[(4Z)-4-benzoyloxyimino-4-(9,9-diethylfluoren-2-yl)-3-methylbutan-2-ylidene]amino] benzoate.
| Compound Name | [(E)-[(4Z)-4-benzoyloxyimino-4-(9,9-diethylfluoren-2-yl)-3-methylbutan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 122485360 |
| Molecular Formula | C36H34N2O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | [(E)-[(4Z)-4-benzoyloxyimino-4-(9,9-diethylfluoren-2-yl)-3-methylbutan-2-ylidene]amino] benzoate |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(/C(=N\OC(=O)c3ccccc3)C(C)/C(C)=N/OC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C36H34N2O4/c1-5-36(6-2)31-20-14-13-19-29(31)30-22-21-28(23-32(30)36)33(38-42-35(40)27-17-11-8-12-18-27)24(3)25(4)37-41-34(39)26-15-9-7-10-16-26/h7-24H,5-6H2,1-4H3/b37-25+,38-33- |
| InChIKey | UMWITJBZMLGEHN-FVIWEOBPSA-N |
| XLogP | 8.20 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|