C35H31N3O6 — CID 122485269
[(E)-1-[7-[(E)-N-benzoyloxy-C-methylcarbonimidoyl]-9,9-diethyl-5-nitrofluoren-2-yl]ethylideneamino] benzoate (PubChem CID 122485269) has the molecular formula C35H31N3O6 and a molecular weight of 589.65 g/mol. Its IUPAC name is [(E)-1-[7-[(E)-N-benzoyloxy-C-methylcarbonimidoyl]-9,9-diethyl-5-nitrofluoren-2-yl]ethylideneamino] benzoate.
| Compound Name | [(E)-1-[7-[(E)-N-benzoyloxy-C-methylcarbonimidoyl]-9,9-diethyl-5-nitrofluoren-2-yl]ethylideneamino] benzoate |
|---|---|
| PubChem CID | 122485269 |
| Molecular Formula | C35H31N3O6 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | [(E)-1-[7-[(E)-N-benzoyloxy-C-methylcarbonimidoyl]-9,9-diethyl-5-nitrofluoren-2-yl]ethylideneamino] benzoate |
| SMILES | CCC1(CC)c2cc(/C(C)=N/OC(=O)c3ccccc3)ccc2-c2c([N+](=O)[O-])cc(/C(C)=N/OC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C35H31N3O6/c1-5-35(6-2)29-19-26(22(3)36-43-33(39)24-13-9-7-10-14-24)17-18-28(29)32-30(35)20-27(21-31(32)38(41)42)23(4)37-44-34(40)25-15-11-8-12-16-25/h7-21H,5-6H2,1-4H3/b36-22+,37-23+ |
| InChIKey | WLPDGANOMSUYKP-BVDGQYGUSA-N |
| XLogP | 7.84 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|