C37H43N3O8 — CID 122485270
[(E)-[1-[7-[(2E)-2-(cyclohexanecarbonyloxyimino)propanoyl]-9,9-diethyl-5-nitrofluoren-2-yl]-1-oxopropan-2-ylidene]amino] cyclohexanecarboxylate (PubChem CID 122485270) has the molecular formula C37H43N3O8 and a molecular weight of 657.76 g/mol. Its IUPAC name is [(E)-[1-[7-[(2E)-2-(cyclohexanecarbonyloxyimino)propanoyl]-9,9-diethyl-5-nitrofluoren-2-yl]-1-oxopropan-2-ylidene]amino] cyclohexanecarboxylate.
| Compound Name | [(E)-[1-[7-[(2E)-2-(cyclohexanecarbonyloxyimino)propanoyl]-9,9-diethyl-5-nitrofluoren-2-yl]-1-oxopropan-2-ylidene]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 122485270 |
| Molecular Formula | C37H43N3O8 |
| Molecular Weight | 657.76 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | [(E)-[1-[7-[(2E)-2-(cyclohexanecarbonyloxyimino)propanoyl]-9,9-diethyl-5-nitrofluoren-2-yl]-1-oxopropan-2-ylidene]amino] cyclohexanecarboxylate |
| SMILES | CCC1(CC)c2cc(C(=O)/C(C)=N/OC(=O)C3CCCCC3)ccc2-c2c([N+](=O)[O-])cc(C(=O)/C(C)=N/OC(=O)C3CCCCC3)cc21 |
| InChI | InChI=1S/C37H43N3O8/c1-5-37(6-2)29-19-26(33(41)22(3)38-47-35(43)24-13-9-7-10-14-24)17-18-28(29)32-30(37)20-27(21-31(32)40(45)46)34(42)23(4)39-48-36(44)25-15-11-8-12-16-25/h17-21,24-25H,5-16H2,1-4H3/b38-22+,39-23+ |
| InChIKey | IBDOLQWDOCEVAC-FXBANDFYSA-N |
| XLogP | 8.05 |
| TPSA | 154.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.76 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|