C24H27NO3 — CID 122695465
[(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] butanoate (PubChem CID 122695465) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is [(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] butanoate.
| Compound Name | [(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] butanoate |
|---|---|
| PubChem CID | 122695465 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] butanoate |
| SMILES | CCCC(=O)O/N=C(/C)C(=O)c1ccc2c(c1)C(CC)(CC)c1ccccc1-2 |
| InChI | InChI=1S/C24H27NO3/c1-5-10-22(26)28-25-16(4)23(27)17-13-14-19-18-11-8-9-12-20(18)24(6-2,7-3)21(19)15-17/h8-9,11-15H,5-7,10H2,1-4H3/b25-16- |
| InChIKey | LUYGCRONBGEFLM-XYGWBWBKSA-N |
| XLogP | 5.68 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|