C61H78N2O6 — CID 134185664
[(Z)-[1-[9,9-dibutyl-5-[4-[9-butyl-2-[(2Z)-2-hexanoyloxyiminopropanoyl]fluoren-9-yl]butyl]fluoren-2-yl]-1-oxopropan-2-ylidene]amino] heptanoate (PubChem CID 134185664) has the molecular formula C61H78N2O6 and a molecular weight of 935.30 g/mol. Its IUPAC name is [(Z)-[1-[9,9-dibutyl-5-[4-[9-butyl-2-[(2Z)-2-hexanoyloxyiminopropanoyl]fluoren-9-yl]butyl]fluoren-2-yl]-1-oxopropan-2-ylidene]amino] heptanoate.
| Compound Name | [(Z)-[1-[9,9-dibutyl-5-[4-[9-butyl-2-[(2Z)-2-hexanoyloxyiminopropanoyl]fluoren-9-yl]butyl]fluoren-2-yl]-1-oxopropan-2-ylidene]amino] heptanoate |
|---|---|
| PubChem CID | 134185664 |
| Molecular Formula | C61H78N2O6 |
| Molecular Weight | 935.30 g/mol |
| Exact Mass | 934.59 |
| IUPAC Name | [(Z)-[1-[9,9-dibutyl-5-[4-[9-butyl-2-[(2Z)-2-hexanoyloxyiminopropanoyl]fluoren-9-yl]butyl]fluoren-2-yl]-1-oxopropan-2-ylidene]amino] heptanoate |
| SMILES | CCCCCCC(=O)O/N=C(/C)C(=O)c1ccc2c(c1)C(CCCC)(CCCC)c1cccc(CCCCC3(CCCC)c4ccccc4-c4ccc(C(=O)/C(C)=N\OC(=O)CCCCC)cc43)c1-2 |
| InChI | InChI=1S/C61H78N2O6/c1-8-13-18-20-32-56(65)69-63-44(7)59(67)47-34-36-50-54(42-47)61(38-16-11-4,39-17-12-5)52-30-25-27-45(57(50)52)26-23-24-40-60(37-15-10-3)51-29-22-21-28-48(51)49-35-33-46(41-53(49)60)58(66)43(6)62-68-55(64)31-19-14-9-2/h21-22,25,27-30,33-36,41-42H,8-20,23-24,26,31-32,37-40H2,1-7H3/b62-43-,63-44- |
| InChIKey | ALGWCKHXQJMJED-LHSRUUEBSA-N |
| XLogP | 15.96 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.30 |
| LogP ≤ 5 | 15.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|