C33H45NO2 — CID 145288770
[(E)-[3-cyclohexyl-1-(9,9-dibutylfluoren-2-yl)propylidene]amino] propanoate (PubChem CID 145288770) has the molecular formula C33H45NO2 and a molecular weight of 487.73 g/mol. Its IUPAC name is [(E)-[3-cyclohexyl-1-(9,9-dibutylfluoren-2-yl)propylidene]amino] propanoate.
| Compound Name | [(E)-[3-cyclohexyl-1-(9,9-dibutylfluoren-2-yl)propylidene]amino] propanoate |
|---|---|
| PubChem CID | 145288770 |
| Molecular Formula | C33H45NO2 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | [(E)-[3-cyclohexyl-1-(9,9-dibutylfluoren-2-yl)propylidene]amino] propanoate |
| SMILES | CCCCC1(CCCC)c2ccccc2-c2ccc(/C(CCC3CCCCC3)=N/OC(=O)CC)cc21 |
| InChI | InChI=1S/C33H45NO2/c1-4-7-22-33(23-8-5-2)29-17-13-12-16-27(29)28-20-19-26(24-30(28)33)31(34-36-32(35)6-3)21-18-25-14-10-9-11-15-25/h12-13,16-17,19-20,24-25H,4-11,14-15,18,21-23H2,1-3H3/b34-31+ |
| InChIKey | JROYQAZQTSIBOX-WUVHBKSUSA-N |
| XLogP | 9.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|