C42H53NO3 — CID 162451753
[(Z)-[3-cyclohexyl-1-[9,9-dibutyl-7-(2,4,6-trimethylbenzoyl)fluoren-2-yl]propylidene]amino] acetate (PubChem CID 162451753) has the molecular formula C42H53NO3 and a molecular weight of 619.89 g/mol. Its IUPAC name is [(Z)-[3-cyclohexyl-1-[9,9-dibutyl-7-(2,4,6-trimethylbenzoyl)fluoren-2-yl]propylidene]amino] acetate.
| Compound Name | [(Z)-[3-cyclohexyl-1-[9,9-dibutyl-7-(2,4,6-trimethylbenzoyl)fluoren-2-yl]propylidene]amino] acetate |
|---|---|
| PubChem CID | 162451753 |
| Molecular Formula | C42H53NO3 |
| Molecular Weight | 619.89 g/mol |
| Exact Mass | 619.40 |
| IUPAC Name | [(Z)-[3-cyclohexyl-1-[9,9-dibutyl-7-(2,4,6-trimethylbenzoyl)fluoren-2-yl]propylidene]amino] acetate |
| SMILES | CCCCC1(CCCC)c2cc(C(=O)c3c(C)cc(C)cc3C)ccc2-c2ccc(/C(CCC3CCCCC3)=N\OC(C)=O)cc21 |
| InChI | InChI=1S/C42H53NO3/c1-7-9-22-42(23-10-8-2)37-26-33(39(43-46-31(6)44)21-16-32-14-12-11-13-15-32)17-19-35(37)36-20-18-34(27-38(36)42)41(45)40-29(4)24-28(3)25-30(40)5/h17-20,24-27,32H,7-16,21-23H2,1-6H3/b43-39- |
| InChIKey | QINLYQPDHNIYRQ-MBJURZOESA-N |
| XLogP | 11.12 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.89 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|