C31H40N2O4 — CID 162451757
[(Z)-[3-cyclopentyl-1-(9,9-dibutyl-7-nitrofluoren-2-yl)propylidene]amino] acetate (PubChem CID 162451757) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is [(Z)-[3-cyclopentyl-1-(9,9-dibutyl-7-nitrofluoren-2-yl)propylidene]amino] acetate.
| Compound Name | [(Z)-[3-cyclopentyl-1-(9,9-dibutyl-7-nitrofluoren-2-yl)propylidene]amino] acetate |
|---|---|
| PubChem CID | 162451757 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | [(Z)-[3-cyclopentyl-1-(9,9-dibutyl-7-nitrofluoren-2-yl)propylidene]amino] acetate |
| SMILES | CCCCC1(CCCC)c2cc(/C(CCC3CCCC3)=N\OC(C)=O)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C31H40N2O4/c1-4-6-18-31(19-7-5-2)28-20-24(30(32-37-22(3)34)17-12-23-10-8-9-11-23)13-15-26(28)27-16-14-25(33(35)36)21-29(27)31/h13-16,20-21,23H,4-12,17-19H2,1-3H3/b32-30- |
| InChIKey | YIIUOIFMDJUVOI-GCUVURNUSA-N |
| XLogP | 8.48 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|