C30H38N2O6 — CID 164786843
propyl (5Z)-5-(7-nitro-9,9-dipropylfluoren-2-yl)-5-propanoyloxyiminopentanoate (PubChem CID 164786843) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is propyl (5Z)-5-(7-nitro-9,9-dipropylfluoren-2-yl)-5-propanoyloxyiminopentanoate.
| Compound Name | propyl (5Z)-5-(7-nitro-9,9-dipropylfluoren-2-yl)-5-propanoyloxyiminopentanoate |
|---|---|
| PubChem CID | 164786843 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | propyl (5Z)-5-(7-nitro-9,9-dipropylfluoren-2-yl)-5-propanoyloxyiminopentanoate |
| SMILES | CCCOC(=O)CCC/C(=N/OC(=O)CC)c1ccc2c(c1)C(CCC)(CCC)c1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C30H38N2O6/c1-5-16-30(17-6-2)25-19-21(12-14-23(25)24-15-13-22(32(35)36)20-26(24)30)27(31-38-28(33)8-4)10-9-11-29(34)37-18-7-3/h12-15,19-20H,5-11,16-18H2,1-4H3/b31-27- |
| InChIKey | PZHQNMAJFBVLHF-QVTSOHHYSA-N |
| XLogP | 7.24 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|