C27H27NO3 — CID 118371862
(2-methylphenyl)-(7-nitro-9,9-dipropylfluoren-2-yl)methanone (PubChem CID 118371862) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2-methylphenyl)-(7-nitro-9,9-dipropylfluoren-2-yl)methanone.
| Compound Name | (2-methylphenyl)-(7-nitro-9,9-dipropylfluoren-2-yl)methanone |
|---|---|
| PubChem CID | 118371862 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2-methylphenyl)-(7-nitro-9,9-dipropylfluoren-2-yl)methanone |
| SMILES | CCCC1(CCC)c2cc(C(=O)c3ccccc3C)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C27H27NO3/c1-4-14-27(15-5-2)24-16-19(26(29)21-9-7-6-8-18(21)3)10-12-22(24)23-13-11-20(28(30)31)17-25(23)27/h6-13,16-17H,4-5,14-15H2,1-3H3 |
| InChIKey | FTBJFIHBESNBPV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|