C53H53N3O5 — CID 129094210
N-[bis[1-(2-methylphenyl)-7-nitro-9,9-dipropylfluoren-2-yl]methylidene]hydroxylamine (PubChem CID 129094210) has the molecular formula C53H53N3O5 and a molecular weight of 812.02 g/mol. Its IUPAC name is N-[bis[1-(2-methylphenyl)-7-nitro-9,9-dipropylfluoren-2-yl]methylidene]hydroxylamine.
| Compound Name | N-[bis[1-(2-methylphenyl)-7-nitro-9,9-dipropylfluoren-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 129094210 |
| Molecular Formula | C53H53N3O5 |
| Molecular Weight | 812.02 g/mol |
| Exact Mass | 811.40 |
| IUPAC Name | N-[bis[1-(2-methylphenyl)-7-nitro-9,9-dipropylfluoren-2-yl]methylidene]hydroxylamine |
| SMILES | CCCC1(CCC)c2cc([N+](=O)[O-])ccc2-c2ccc(C(=NO)c3ccc4c(c3-c3ccccc3C)C(CCC)(CCC)c3cc([N+](=O)[O-])ccc3-4)c(-c3ccccc3C)c21 |
| InChI | InChI=1S/C53H53N3O5/c1-7-27-52(28-8-2)45-31-35(55(58)59)19-21-39(45)41-23-25-43(47(49(41)52)37-17-13-11-15-33(37)5)51(54-57)44-26-24-42-40-22-20-36(56(60)61)32-46(40)53(29-9-3,30-10-4)50(42)48(44)38-18-14-12-16-34(38)6/h11-26,31-32,57H,7-10,27-30H2,1-6H3 |
| InChIKey | GGFVSEWKMYHTAN-UHFFFAOYSA-N |
| XLogP | 14.41 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.02 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|