C23H28N2O3 — CID 131735412
N-[1-(9,9-dibutyl-7-nitrofluoren-2-yl)ethylidene]hydroxylamine (PubChem CID 131735412) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[1-(9,9-dibutyl-7-nitrofluoren-2-yl)ethylidene]hydroxylamine.
| Compound Name | N-[1-(9,9-dibutyl-7-nitrofluoren-2-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 131735412 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[1-(9,9-dibutyl-7-nitrofluoren-2-yl)ethylidene]hydroxylamine |
| SMILES | CCCCC1(CCCC)c2cc(C(C)=NO)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C23H28N2O3/c1-4-6-12-23(13-7-5-2)21-14-17(16(3)24-26)8-10-19(21)20-11-9-18(25(27)28)15-22(20)23/h8-11,14-15,26H,4-7,12-13H2,1-3H3 |
| InChIKey | VFSCQHDZMFJHQZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|