C39H47N3O2 — CID 102098891
2-(7-nitro-9,9-dioctylfluoren-2-yl)-6-pyridin-2-ylpyridine (PubChem CID 102098891) has the molecular formula C39H47N3O2 and a molecular weight of 589.82 g/mol. Its IUPAC name is 2-(7-nitro-9,9-dioctylfluoren-2-yl)-6-pyridin-2-ylpyridine.
| Compound Name | 2-(7-nitro-9,9-dioctylfluoren-2-yl)-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102098891 |
| Molecular Formula | C39H47N3O2 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | 2-(7-nitro-9,9-dioctylfluoren-2-yl)-6-pyridin-2-ylpyridine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3cccc(-c4ccccn4)n3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C39H47N3O2/c1-3-5-7-9-11-14-25-39(26-15-12-10-8-6-4-2)34-28-30(36-19-17-20-38(41-36)37-18-13-16-27-40-37)21-23-32(34)33-24-22-31(42(43)44)29-35(33)39/h13,16-24,27-29H,3-12,14-15,25-26H2,1-2H3 |
| InChIKey | MUMAAGVLXKSQIL-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|